C17H25N3O2 — CID 44724216
1-phenyl-3-[(2,5,5-trimethyl-4-oxohept-6-en-2-yl)amino]urea (PubChem CID 44724216) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-phenyl-3-[(2,5,5-trimethyl-4-oxohept-6-en-2-yl)amino]urea.
| Compound Name | 1-phenyl-3-[(2,5,5-trimethyl-4-oxohept-6-en-2-yl)amino]urea |
|---|---|
| PubChem CID | 44724216 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-phenyl-3-[(2,5,5-trimethyl-4-oxohept-6-en-2-yl)amino]urea |
| SMILES | C=CC(C)(C)C(=O)CC(C)(C)NNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H25N3O2/c1-6-16(2,3)14(21)12-17(4,5)20-19-15(22)18-13-10-8-7-9-11-13/h6-11,20H,1,12H2,2-5H3,(H2,18,19,22) |
| InChIKey | KMSOKNYPXPHARZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|