C22H27N3O5S — CID 44757462
benzyl N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-propan-2-ylsulfanylethyl]carbamate (PubChem CID 44757462) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is benzyl N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-propan-2-ylsulfanylethyl]carbamate.
| Compound Name | benzyl N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-propan-2-ylsulfanylethyl]carbamate |
|---|---|
| PubChem CID | 44757462 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | benzyl N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-propan-2-ylsulfanylethyl]carbamate |
| SMILES | CC(C)SC(NC(=O)OCc1ccccc1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H27N3O5S/c1-16(2)31-19(23-22(28)30-15-17-7-4-3-5-8-17)21(27)25-12-10-24(11-13-25)20(26)18-9-6-14-29-18/h3-9,14,16,19H,10-13,15H2,1-2H3,(H,23,28) |
| InChIKey | KVKZJZFKCINWHB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|