C17H24N4O2S — CID 44757812
N-[3-(N-methylanilino)propyl]-3-(6-oxo-2-sulfanylidene-1,3-diazinan-1-yl)propanamide (PubChem CID 44757812) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-3-(6-oxo-2-sulfanylidene-1,3-diazinan-1-yl)propanamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-3-(6-oxo-2-sulfanylidene-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 44757812 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-3-(6-oxo-2-sulfanylidene-1,3-diazinan-1-yl)propanamide |
| SMILES | CN(CCCNC(=O)CCN1C(=O)CCNC1=S)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O2S/c1-20(14-6-3-2-4-7-14)12-5-10-18-15(22)9-13-21-16(23)8-11-19-17(21)24/h2-4,6-7H,5,8-13H2,1H3,(H,18,22)(H,19,24) |
| InChIKey | JSYUSJNHBMURAN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|