C20H25N5O2 — CID 44760715
N'-methyl-4-oxo-N'-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butanehydrazide (PubChem CID 44760715) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N'-methyl-4-oxo-N'-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butanehydrazide.
| Compound Name | N'-methyl-4-oxo-N'-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 44760715 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N'-methyl-4-oxo-N'-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)butanehydrazide |
| SMILES | CN(NC(=O)CCC(=O)N1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H25N5O2/c1-23(17-7-3-2-4-8-17)22-19(26)10-11-20(27)25-15-13-24(14-16-25)18-9-5-6-12-21-18/h2-9,12H,10-11,13-16H2,1H3,(H,22,26) |
| InChIKey | WMHUMFRUWWZVCP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|