C27H32N4O4 — CID 44761695
methyl 3-phenyl-2-[[6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carbonyl]amino]propanoate (PubChem CID 44761695) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is methyl 3-phenyl-2-[[6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carbonyl]amino]propanoate.
| Compound Name | methyl 3-phenyl-2-[[6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 44761695 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl 3-phenyl-2-[[6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C1CC=CCC1C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C27H32N4O4/c1-35-27(34)23(19-20-9-3-2-4-10-20)29-25(32)21-11-5-6-12-22(21)26(33)31-17-15-30(16-18-31)24-13-7-8-14-28-24/h2-10,13-14,21-23H,11-12,15-19H2,1H3,(H,29,32) |
| InChIKey | KBTKZEFJAWLKLA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|