C23H32N4O2 — CID 44761689
N-cyclohexyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 44761689) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-cyclohexyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-cyclohexyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 44761689 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-cyclohexyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CC=CCC1C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H32N4O2/c28-22(25-18-8-2-1-3-9-18)19-10-4-5-11-20(19)23(29)27-16-14-26(15-17-27)21-12-6-7-13-24-21/h4-7,12-13,18-20H,1-3,8-11,14-17H2,(H,25,28) |
| InChIKey | FTPSVNDXAHZBOA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|