C23H25F3N4O — CID 44763218
4-[5-amino-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]-N-(4-methylpentan-2-yl)benzamide (PubChem CID 44763218) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[5-amino-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]-N-(4-methylpentan-2-yl)benzamide.
| Compound Name | 4-[5-amino-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]-N-(4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 44763218 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-[5-amino-3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]-N-(4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(C)NC(=O)c1ccc(-n2nc(-c3cccc(C(F)(F)F)c3)cc2N)cc1 |
| InChI | InChI=1S/C23H25F3N4O/c1-14(2)11-15(3)28-22(31)16-7-9-19(10-8-16)30-21(27)13-20(29-30)17-5-4-6-18(12-17)23(24,25)26/h4-10,12-15H,11,27H2,1-3H3,(H,28,31) |
| InChIKey | WBDVIACPUJKNQU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |