C24H24Cl2N4O — CID 44763554
4-[5-amino-3-(3,4-dichlorophenyl)pyrazol-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]benzamide (PubChem CID 44763554) has the molecular formula C24H24Cl2N4O and a molecular weight of 455.39 g/mol. Its IUPAC name is 4-[5-amino-3-(3,4-dichlorophenyl)pyrazol-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]benzamide.
| Compound Name | 4-[5-amino-3-(3,4-dichlorophenyl)pyrazol-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 44763554 |
| Molecular Formula | C24H24Cl2N4O |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-[5-amino-3-(3,4-dichlorophenyl)pyrazol-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]benzamide |
| SMILES | Nc1cc(-c2ccc(Cl)c(Cl)c2)nn1-c1ccc(C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C24H24Cl2N4O/c25-20-11-8-18(14-21(20)26)22-15-23(27)30(29-22)19-9-6-17(7-10-19)24(31)28-13-12-16-4-2-1-3-5-16/h4,6-11,14-15H,1-3,5,12-13,27H2,(H,28,31) |
| InChIKey | LVDIYJAKTLQPTF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|