C25H24N4O3 — CID 44763648
4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-(2,5-dimethoxyphenyl)benzamide (PubChem CID 44763648) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-(2,5-dimethoxyphenyl)benzamide.
| Compound Name | 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-(2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 44763648 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-(2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(-n3nc(-c4cccc(C)c4)cc3N)cc2)c1 |
| InChI | InChI=1S/C25H24N4O3/c1-16-5-4-6-18(13-16)21-15-24(26)29(28-21)19-9-7-17(8-10-19)25(30)27-22-14-20(31-2)11-12-23(22)32-3/h4-15H,26H2,1-3H3,(H,27,30) |
| InChIKey | QUCYHNQFOZZONX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |