C32H28N4O — CID 44763799
N-(1-benzylpyrrolidin-3-yl)-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 44763799) has the molecular formula C32H28N4O and a molecular weight of 484.60 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 44763799 |
| Molecular Formula | C32H28N4O |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C32H28N4O/c37-32(33-27-18-19-36(22-27)21-23-10-4-1-5-11-23)26-16-17-28-29(20-26)35-31(25-14-8-3-9-15-25)30(34-28)24-12-6-2-7-13-24/h1-17,20,27H,18-19,21-22H2,(H,33,37) |
| InChIKey | DBAYAVCNYQEZFD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |