C22H33N3O2 — CID 44764167
N-(4-tert-butylcyclohexyl)-1-(N-methylanilino)-5-oxopyrrolidine-3-carboxamide (PubChem CID 44764167) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-1-(N-methylanilino)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-1-(N-methylanilino)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 44764167 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-1-(N-methylanilino)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(c1ccccc1)N1CC(C(=O)NC2CCC(C(C)(C)C)CC2)CC1=O |
| InChI | InChI=1S/C22H33N3O2/c1-22(2,3)17-10-12-18(13-11-17)23-21(27)16-14-20(26)25(15-16)24(4)19-8-6-5-7-9-19/h5-9,16-18H,10-15H2,1-4H3,(H,23,27) |
| InChIKey | KMPRCIJVOXWRQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |