C22H30F3N5O3 — CID 44764932
tert-butyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate (PubChem CID 44764932) has the molecular formula C22H30F3N5O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is tert-butyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 44764932 |
| Molecular Formula | C22H30F3N5O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | tert-butyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N1CCCC1c1nnc2c(C(F)(F)F)cccn12 |
| InChI | InChI=1S/C22H30F3N5O3/c1-21(2,3)33-20(32)26-12-6-4-5-11-17(31)29-13-8-10-16(29)19-28-27-18-15(22(23,24)25)9-7-14-30(18)19/h7,9,14,16H,4-6,8,10-13H2,1-3H3,(H,26,32) |
| InChIKey | IFUZPPOHRNZKNR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|