C17H20N2O4S — CID 44775648
2-(2,5-dimethoxyphenyl)sulfanyl-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 44775648) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)sulfanyl-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)sulfanyl-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44775648 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)sulfanyl-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cccnc1Sc1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H20N2O4S/c1-21-10-9-18-16(20)13-5-4-8-19-17(13)24-15-11-12(22-2)6-7-14(15)23-3/h4-8,11H,9-10H2,1-3H3,(H,18,20) |
| InChIKey | LUKRVXGTPAFBQW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|