C21H20N2O3S — CID 10339739
2-benzylsulfanyl-N-(2,5-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 10339739) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,5-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 2-benzylsulfanyl-N-(2,5-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10339739 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,5-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccnc2SCc2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2O3S/c1-25-16-10-11-19(26-2)18(13-16)23-20(24)17-9-6-12-22-21(17)27-14-15-7-4-3-5-8-15/h3-13H,14H2,1-2H3,(H,23,24) |
| InChIKey | UHQXJADTSGMTQS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |