C25H31N5O — CID 44783424
2-(1H-benzimidazol-2-yl)-4-benzyl-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 44783424) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-benzyl-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-benzyl-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 44783424 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-benzyl-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(Cc2ccccc2)CC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H31N5O/c31-25(26-20-11-5-2-6-12-20)30-16-15-29(17-19-9-3-1-4-10-19)18-23(30)24-27-21-13-7-8-14-22(21)28-24/h1,3-4,7-10,13-14,20,23H,2,5-6,11-12,15-18H2,(H,26,31)(H,27,28) |
| InChIKey | ZZDYNDLROMFWDH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |