C10H18Br2N2O — CID 44783854
(4-bromo-3-methyl-1,2-oxazol-5-yl)methyl-diethyl-methylazanium bromide (PubChem CID 44783854) has the molecular formula C10H18Br2N2O and a molecular weight of 342.08 g/mol. Its IUPAC name is (4-bromo-3-methyl-1,2-oxazol-5-yl)methyl-diethyl-methylazanium bromide.
| Compound Name | (4-bromo-3-methyl-1,2-oxazol-5-yl)methyl-diethyl-methylazanium bromide |
|---|---|
| PubChem CID | 44783854 |
| Molecular Formula | C10H18Br2N2O |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | (4-bromo-3-methyl-1,2-oxazol-5-yl)methyl-diethyl-methylazanium bromide |
| SMILES | CC[N+](C)(CC)Cc1onc(C)c1Br.[Br-] |
| InChI | InChI=1S/C10H18BrN2O.BrH/c1-5-13(4,6-2)7-9-10(11)8(3)12-14-9;/h5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PTRNQIHANIHNAY-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|