C12H14BrClN2O — CID 44789320
2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-chlorophenyl)ethanone bromide (PubChem CID 44789320) has the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. Its IUPAC name is 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-chlorophenyl)ethanone bromide.
| Compound Name | 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-chlorophenyl)ethanone bromide |
|---|---|
| PubChem CID | 44789320 |
| Molecular Formula | C12H14BrClN2O |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)-1-(4-chlorophenyl)ethanone bromide |
| SMILES | NC1=[N+](CC(=O)c2ccc(Cl)cc2)CCC1.[Br-] |
| InChI | InChI=1S/C12H13ClN2O.BrH/c13-10-5-3-9(4-6-10)11(16)8-15-7-1-2-12(15)14;/h3-6,14H,1-2,7-8H2;1H |
| InChIKey | MHJJLRWHQRUYDJ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|