C23H20F2N2O5S — CID 44815489
2-[[5-[[4-(2,6-difluoro-4-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 44815489) has the molecular formula C23H20F2N2O5S and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-[[5-[[4-(2,6-difluoro-4-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[[4-(2,6-difluoro-4-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 44815489 |
| Molecular Formula | C23H20F2N2O5S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[[5-[[4-(2,6-difluoro-4-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCCC2NS(=O)(=O)c1ccc(-c2cc(F)nc(F)c2)cc1 |
| InChI | InChI=1S/C23H20F2N2O5S/c24-21-11-15(12-22(25)26-21)14-7-9-16(10-8-14)33(30,31)27-19-5-1-4-18-17(19)3-2-6-20(18)32-13-23(28)29/h2-3,6-12,19,27H,1,4-5,13H2,(H,28,29) |
| InChIKey | LOAXZJLABKEKMM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|