About bis(cyclopropylmethoxymethanedithiolate);platinum(4+)
bis(cyclopropylmethoxymethanedithiolate);platinum(4+) (PubChem CID 44826214) has the molecular formula C10H16O2PtS4
and a molecular weight of 491.58 g/mol. Its IUPAC name is bis(cyclopropylmethoxymethanedithiolate);platinum(4+).
Molecular Properties
| Compound Name | bis(cyclopropylmethoxymethanedithiolate);platinum(4+) |
| PubChem CID | 44826214 |
| Molecular Formula | C10H16O2PtS4 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | bis(cyclopropylmethoxymethanedithiolate);platinum(4+) |
| SMILES | [Pt+4].[S-]C([S-])OCC1CC1.[S-]C([S-])OCC1CC1 |
| InChI | InChI=1S/2C5H10OS2.Pt/c2*7-5(8)6-3-4-1-2-4;/h2*4-5,7-8H,1-3H2;/q;;+4/p-4 |
| InChIKey | JRMRYKKKXYVOCN-UHFFFAOYSA-J |
| XLogP | 1.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopropylmethoxymethanedithiolate);platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopropylmethoxymethanedithiolate);platinum(4+)?
The IUPAC name of bis(cyclopropylmethoxymethanedithiolate);platinum(4+) (CID 44826214) is bis(cyclopropylmethoxymethanedithiolate);platinum(4+).
What is the SMILES notation for bis(cyclopropylmethoxymethanedithiolate);platinum(4+)?
The canonical SMILES for bis(cyclopropylmethoxymethanedithiolate);platinum(4+) is [Pt+4].[S-]C([S-])OCC1CC1.[S-]C([S-])OCC1CC1.
What is the InChIKey of bis(cyclopropylmethoxymethanedithiolate);platinum(4+)?
The InChIKey is JRMRYKKKXYVOCN-UHFFFAOYSA-J. The full InChI is InChI=1S/2C5H10OS2.Pt/c2*7-5(8)6-3-4-1-2-4;/h2*4-5,7-8H,1-3H2;/q;;+4/p-4.
What are the key properties of bis(cyclopropylmethoxymethanedithiolate);platinum(4+)?
bis(cyclopropylmethoxymethanedithiolate);platinum(4+) has a molecular weight of 491.58 g/mol, XLogP of 1.58, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopropylmethoxymethanedithiolate);platinum(4+) is sourced from PubChem (CID 44826214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).