C24H24N6O4S — CID 44827461
N'-(4-acetamidophenyl)-N-[2-[2-(4-methoxyphenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]oxamide (PubChem CID 44827461) has the molecular formula C24H24N6O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-[2-[2-(4-methoxyphenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-[2-[2-(4-methoxyphenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 44827461 |
| Molecular Formula | C24H24N6O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-[2-[2-(4-methoxyphenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]oxamide |
| SMILES | COc1ccc(-c2nc3sc(CCNC(=O)C(=O)Nc4ccc(NC(C)=O)cc4)c(C)n3n2)cc1 |
| InChI | InChI=1S/C24H24N6O4S/c1-14-20(35-24-28-21(29-30(14)24)16-4-10-19(34-3)11-5-16)12-13-25-22(32)23(33)27-18-8-6-17(7-9-18)26-15(2)31/h4-11H,12-13H2,1-3H3,(H,25,32)(H,26,31)(H,27,33) |
| InChIKey | KEBMRISMYYVDML-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|