C23H20N4O2S — CID 44833604
(5Z)-2-amino-5-[[3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 44833604) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 44833604 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (5Z)-2-amino-5-[[3-(2,7-dimethyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(-c2nn(-c3ccccc3)cc2/C=C2\SC(N)=NC2=O)cc2c1OC(C)C2 |
| InChI | InChI=1S/C23H20N4O2S/c1-13-8-15(10-16-9-14(2)29-21(13)16)20-17(11-19-22(28)25-23(24)30-19)12-27(26-20)18-6-4-3-5-7-18/h3-8,10-12,14H,9H2,1-2H3,(H2,24,25,28)/b19-11- |
| InChIKey | JDAMUIIDMZWHPF-ODLFYWEKSA-N |
| XLogP | 4.10 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|