C18H15ClO2 — CID 44850299
(2Z)-5-chloro-2-[(4-ethylphenyl)methylidene]-6-methyl-1-benzofuran-3-one (PubChem CID 44850299) has the molecular formula C18H15ClO2 and a molecular weight of 298.77 g/mol. Its IUPAC name is (2Z)-5-chloro-2-[(4-ethylphenyl)methylidene]-6-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-5-chloro-2-[(4-ethylphenyl)methylidene]-6-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 44850299 |
| Molecular Formula | C18H15ClO2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2Z)-5-chloro-2-[(4-ethylphenyl)methylidene]-6-methyl-1-benzofuran-3-one |
| SMILES | CCc1ccc(/C=C2\Oc3cc(C)c(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C18H15ClO2/c1-3-12-4-6-13(7-5-12)9-17-18(20)14-10-15(19)11(2)8-16(14)21-17/h4-10H,3H2,1-2H3/b17-9- |
| InChIKey | XEFNPGMXYRGTBH-MFOYZWKCSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|