C23H21BF4O — CID 44888076
7-phenyl-5,6,8,9,10,11-hexahydrobenzo[c]xanthen-12-ium tetrafluoroborate (PubChem CID 44888076) has the molecular formula C23H21BF4O and a molecular weight of 400.22 g/mol. Its IUPAC name is 7-phenyl-5,6,8,9,10,11-hexahydrobenzo[c]xanthen-12-ium tetrafluoroborate.
| Compound Name | 7-phenyl-5,6,8,9,10,11-hexahydrobenzo[c]xanthen-12-ium tetrafluoroborate |
|---|---|
| PubChem CID | 44888076 |
| Molecular Formula | C23H21BF4O |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 7-phenyl-5,6,8,9,10,11-hexahydrobenzo[c]xanthen-12-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2c3c([o+]c4c2CCc2ccccc2-4)CCCC3)cc1 |
| InChI | InChI=1S/C23H21O.BF4/c1-2-9-17(10-3-1)22-19-12-6-7-13-21(19)24-23-18-11-5-4-8-16(18)14-15-20(22)23;2-1(3,4)5/h1-5,8-11H,6-7,12-15H2;/q+1;-1 |
| InChIKey | LENOUGXKAFDXCC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|