C29H26F3NO3S — CID 44888293
2,4-diphenyl-1-propan-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium;trifluoromethanesulfonate (PubChem CID 44888293) has the molecular formula C29H26F3NO3S and a molecular weight of 525.59 g/mol. Its IUPAC name is 2,4-diphenyl-1-propan-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium;trifluoromethanesulfonate.
| Compound Name | 2,4-diphenyl-1-propan-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888293 |
| Molecular Formula | C29H26F3NO3S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 2,4-diphenyl-1-propan-2-yl-5,6-dihydrobenzo[h]quinolin-1-ium;trifluoromethanesulfonate |
| SMILES | CC(C)[n+]1c(-c2ccccc2)cc(-c2ccccc2)c2c1-c1ccccc1CC2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H26N.CHF3O3S/c1-20(2)29-27(23-14-7-4-8-15-23)19-26(21-11-5-3-6-12-21)25-18-17-22-13-9-10-16-24(22)28(25)29;2-1(3,4)8(5,6)7/h3-16,19-20H,17-18H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FSSYZMCWRFCHQG-UHFFFAOYSA-M |
| XLogP | 6.71 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|