C37H28F3NO3S — CID 122181654
1-methyl-2,6-bis[2-[4-(4-methylphenyl)phenyl]ethynyl]pyridin-1-ium;trifluoromethanesulfonate (PubChem CID 122181654) has the molecular formula C37H28F3NO3S and a molecular weight of 623.70 g/mol. Its IUPAC name is 1-methyl-2,6-bis[2-[4-(4-methylphenyl)phenyl]ethynyl]pyridin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-methyl-2,6-bis[2-[4-(4-methylphenyl)phenyl]ethynyl]pyridin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122181654 |
| Molecular Formula | C37H28F3NO3S |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | 1-methyl-2,6-bis[2-[4-(4-methylphenyl)phenyl]ethynyl]pyridin-1-ium;trifluoromethanesulfonate |
| SMILES | Cc1ccc(-c2ccc(C#Cc3cccc(C#Cc4ccc(-c5ccc(C)cc5)cc4)[n+]3C)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C36H28N.CHF3O3S/c1-27-7-17-31(18-8-27)33-21-11-29(12-22-33)15-25-35-5-4-6-36(37(35)3)26-16-30-13-23-34(24-14-30)32-19-9-28(2)10-20-32;2-1(3,4)8(5,6)7/h4-14,17-24H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DHSPIKQYPLRMDQ-UHFFFAOYSA-M |
| XLogP | 7.31 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|