C18H27NO7 — CID 44891601
2-hydroxy-2-oxoacetate;1-morpholin-4-ium-4-yl-3-(2,4,6-trimethylphenoxy)propan-2-ol (PubChem CID 44891601) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;1-morpholin-4-ium-4-yl-3-(2,4,6-trimethylphenoxy)propan-2-ol.
| Compound Name | 2-hydroxy-2-oxoacetate;1-morpholin-4-ium-4-yl-3-(2,4,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 44891601 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;1-morpholin-4-ium-4-yl-3-(2,4,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(C)c(OCC(O)C[NH+]2CCOCC2)c(C)c1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C16H25NO3.C2H2O4/c1-12-8-13(2)16(14(3)9-12)20-11-15(18)10-17-4-6-19-7-5-17;3-1(4)2(5)6/h8-9,15,18H,4-7,10-11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | JLAFHHTZUKFVOW-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|