C17H18N2O3S — CID 44916334
N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 44916334) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 44916334 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc(-c2cc3cc(OCC)ccc3o2)cs1 |
| InChI | InChI=1S/C17H18N2O3S/c1-3-5-16(20)19-17-18-13(10-23-17)15-9-11-8-12(21-4-2)6-7-14(11)22-15/h6-10H,3-5H2,1-2H3,(H,18,19,20) |
| InChIKey | JGCLKZPIPGAJHO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |