C21H15N3O3S — CID 44916270
4-cyano-N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 44916270) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-cyano-N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-cyano-N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44916270 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-cyano-N-[4-(5-ethoxy-1-benzofuran-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCOc1ccc2oc(-c3csc(NC(=O)c4ccc(C#N)cc4)n3)cc2c1 |
| InChI | InChI=1S/C21H15N3O3S/c1-2-26-16-7-8-18-15(9-16)10-19(27-18)17-12-28-21(23-17)24-20(25)14-5-3-13(11-22)4-6-14/h3-10,12H,2H2,1H3,(H,23,24,25) |
| InChIKey | YAXGGMMTSKKXFO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |