C22H22FNO3 — CID 44916688
(2Z)-2-[(4-fluorophenyl)methylidene]-6-hydroxy-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one (PubChem CID 44916688) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is (2Z)-2-[(4-fluorophenyl)methylidene]-6-hydroxy-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(4-fluorophenyl)methylidene]-6-hydroxy-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 44916688 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2Z)-2-[(4-fluorophenyl)methylidene]-6-hydroxy-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one |
| SMILES | CC1CCCCN1Cc1c(O)ccc2c1O/C(=C\c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C22H22FNO3/c1-14-4-2-3-11-24(14)13-18-19(25)10-9-17-21(26)20(27-22(17)18)12-15-5-7-16(23)8-6-15/h5-10,12,14,25H,2-4,11,13H2,1H3/b20-12- |
| InChIKey | SBHJDINKCJEATJ-NDENLUEZSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|