C23H19N3O4S — CID 44921766
N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 44921766) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 44921766 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nnc(CS(=O)(=O)c2ccccc2)o1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O4S/c27-22(21(17-10-4-1-5-11-17)18-12-6-2-7-13-18)24-23-26-25-20(30-23)16-31(28,29)19-14-8-3-9-15-19/h1-15,21H,16H2,(H,24,26,27) |
| InChIKey | ISXNWWMYCPQCDY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |