C20H16N4O6S — CID 44921756
N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 44921756) has the molecular formula C20H16N4O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 44921756 |
| Molecular Formula | C20H16N4O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[5-(benzenesulfonylmethyl)-1,3,4-oxadiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1nnc(CS(=O)(=O)c2ccccc2)o1)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C20H16N4O6S/c25-17-9-10-18(26)24(17)14-6-4-5-13(11-14)19(27)21-20-23-22-16(30-20)12-31(28,29)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2,(H,21,23,27) |
| InChIKey | VQLRIMSCBDFCQA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|