C21H16Cl2N4O3 — CID 55434210
N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 55434210) has the molecular formula C21H16Cl2N4O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55434210 |
| Molecular Formula | C21H16Cl2N4O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1ccnn1Cc1cccc(Cl)c1Cl)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C21H16Cl2N4O3/c22-16-6-2-4-14(20(16)23)12-26-17(9-10-24-26)25-21(30)13-3-1-5-15(11-13)27-18(28)7-8-19(27)29/h1-6,9-11H,7-8,12H2,(H,25,30) |
| InChIKey | IEPXPMVSWLIHFP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|