C18H13ClN4O — CID 31976011
N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-cyanobenzamide (PubChem CID 31976011) has the molecular formula C18H13ClN4O and a molecular weight of 336.78 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-cyanobenzamide.
| Compound Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 31976011 |
| Molecular Formula | C18H13ClN4O |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2ccnn2Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H13ClN4O/c19-16-7-2-1-5-15(16)12-23-17(8-9-21-23)22-18(24)14-6-3-4-13(10-14)11-20/h1-10H,12H2,(H,22,24) |
| InChIKey | HUODPQPRJICGSZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |