C23H19N3O5S — CID 44921919
N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-4-phenoxybenzamide (PubChem CID 44921919) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 44921919 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-4-phenoxybenzamide |
| SMILES | O=C(Nc1nnc(CCS(=O)(=O)c2ccccc2)o1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O5S/c27-22(17-11-13-19(14-12-17)30-18-7-3-1-4-8-18)24-23-26-25-21(31-23)15-16-32(28,29)20-9-5-2-6-10-20/h1-14H,15-16H2,(H,24,26,27) |
| InChIKey | MDSJGIBZJMPUSG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |