C17H13Cl2N3O4S — CID 44921886
N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-2,5-dichlorobenzamide (PubChem CID 44921886) has the molecular formula C17H13Cl2N3O4S and a molecular weight of 426.28 g/mol. Its IUPAC name is N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-2,5-dichlorobenzamide.
| Compound Name | N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 44921886 |
| Molecular Formula | C17H13Cl2N3O4S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | N-[5-[2-(benzenesulfonyl)ethyl]-1,3,4-oxadiazol-2-yl]-2,5-dichlorobenzamide |
| SMILES | O=C(Nc1nnc(CCS(=O)(=O)c2ccccc2)o1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O4S/c18-11-6-7-14(19)13(10-11)16(23)20-17-22-21-15(26-17)8-9-27(24,25)12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H,20,22,23) |
| InChIKey | RWQUAXJJBGLBBY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |