C24H28N2O3S3 — CID 44948487
4-(4-methoxyphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 44948487) has the molecular formula C24H28N2O3S3 and a molecular weight of 488.70 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-(4-methoxyphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 44948487 |
| Molecular Formula | C24H28N2O3S3 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfanyl-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | COc1ccc(SCCCC(=O)N(CC2CCCO2)c2nc3c(SC)cccc3s2)cc1 |
| InChI | InChI=1S/C24H28N2O3S3/c1-28-17-10-12-19(13-11-17)31-15-5-9-22(27)26(16-18-6-4-14-29-18)24-25-23-20(30-2)7-3-8-21(23)32-24/h3,7-8,10-13,18H,4-6,9,14-16H2,1-2H3 |
| InChIKey | KRDJAUZYHMVZJH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|