C16H15N3O6S — CID 44964443
N-(4-methyl-5-oxo-2,3-dihydro-1,4-benzoxazepin-7-yl)-4-nitrobenzenesulfonamide (PubChem CID 44964443) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is N-(4-methyl-5-oxo-2,3-dihydro-1,4-benzoxazepin-7-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(4-methyl-5-oxo-2,3-dihydro-1,4-benzoxazepin-7-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 44964443 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-(4-methyl-5-oxo-2,3-dihydro-1,4-benzoxazepin-7-yl)-4-nitrobenzenesulfonamide |
| SMILES | CN1CCOc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C16H15N3O6S/c1-18-8-9-25-15-7-2-11(10-14(15)16(18)20)17-26(23,24)13-5-3-12(4-6-13)19(21)22/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | ULVUIZYMFZMXMI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|