C25H27FN4O4S — CID 44976750
3,4,5-triethoxy-N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]benzamide (PubChem CID 44976750) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 44976750 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCc2csc3nc(-c4cccc(F)c4)nn23)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H27FN4O4S/c1-4-32-20-13-17(14-21(33-5-2)22(20)34-6-3)24(31)27-11-10-19-15-35-25-28-23(29-30(19)25)16-8-7-9-18(26)12-16/h7-9,12-15H,4-6,10-11H2,1-3H3,(H,27,31) |
| InChIKey | QZLYMDVBHBBVNG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |