C19H15FN4OS2 — CID 75281546
N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 75281546) has the molecular formula C19H15FN4OS2 and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 75281546 |
| Molecular Formula | C19H15FN4OS2 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[2-[2-(3-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)NCCc1csc2nc(-c3cccc(F)c3)nn12 |
| InChI | InChI=1S/C19H15FN4OS2/c20-14-4-1-3-13(11-14)18-22-19-24(23-18)15(12-27-19)8-9-21-17(25)7-6-16-5-2-10-26-16/h1-7,10-12H,8-9H2,(H,21,25) |
| InChIKey | KHLSEZYDYKEUPJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|