C21H23N3O3 — CID 45001400
1-[2-(benzhydrylamino)-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 45001400) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[2-(benzhydrylamino)-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(benzhydrylamino)-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45001400 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[2-(benzhydrylamino)-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)NC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3O3/c22-19(25)17-11-13-24(14-12-17)21(27)20(26)23-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H2,22,25)(H,23,26) |
| InChIKey | YNTYSGXBECOUHW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|