C17H15ClF3N7O3S — CID 4501079
N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4501079) has the molecular formula C17H15ClF3N7O3S and a molecular weight of 489.87 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4501079 |
| Molecular Formula | C17H15ClF3N7O3S |
| Molecular Weight | 489.87 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)nnc1-c1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C17H15ClF3N7O3S/c1-3-27-15(12-7-13(17(19,20)21)25-26(12)2)23-24-16(27)32-8-14(29)22-9-4-5-10(18)11(6-9)28(30)31/h4-7H,3,8H2,1-2H3,(H,22,29) |
| InChIKey | SHERWEXHKAMSNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|