C17H18ClN7O3S — CID 4633856
N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-(1-ethylpyrazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4633856) has the molecular formula C17H18ClN7O3S and a molecular weight of 435.90 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-(1-ethylpyrazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-(1-ethylpyrazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4633856 |
| Molecular Formula | C17H18ClN7O3S |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[[4-ethyl-5-(1-ethylpyrazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1cc(-c2nnc(SCC(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)n2CC)cn1 |
| InChI | InChI=1S/C17H18ClN7O3S/c1-3-23-9-11(8-19-23)16-21-22-17(24(16)4-2)29-10-15(26)20-12-5-6-13(18)14(7-12)25(27)28/h5-9H,3-4,10H2,1-2H3,(H,20,26) |
| InChIKey | RMZIHVQJQHAJBQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|