C23H18N2O4 — CID 45023199
(6E)-2-methoxy-6-[(2E)-2-(5-methylphenanthridin-6-ylidene)ethylidene]-4-nitrocyclohexa-2,4-dien-1-one (PubChem CID 45023199) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (6E)-2-methoxy-6-[(2E)-2-(5-methylphenanthridin-6-ylidene)ethylidene]-4-nitrocyclohexa-2,4-dien-1-one.
| Compound Name | (6E)-2-methoxy-6-[(2E)-2-(5-methylphenanthridin-6-ylidene)ethylidene]-4-nitrocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 45023199 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (6E)-2-methoxy-6-[(2E)-2-(5-methylphenanthridin-6-ylidene)ethylidene]-4-nitrocyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC([N+](=O)[O-])=C/C(=C\C=C2/c3ccccc3-c3ccccc3N2C)C1=O |
| InChI | InChI=1S/C23H18N2O4/c1-24-20-10-6-5-9-18(20)17-7-3-4-8-19(17)21(24)12-11-15-13-16(25(27)28)14-22(29-2)23(15)26/h3-14H,1-2H3/b15-11+,21-12+ |
| InChIKey | ZFPIJTBWYYZJOO-BLXLCHOJSA-N |
| XLogP | 4.34 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|