C25H29N3O9 — CID 45032250
N-[2-[2-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-nitrophenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 45032250) has the molecular formula C25H29N3O9 and a molecular weight of 515.52 g/mol. Its IUPAC name is N-[2-[2-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-nitrophenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-[2-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-nitrophenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 45032250 |
| Molecular Formula | C25H29N3O9 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[2-[2-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-nitrophenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(Oc2ccc([N+](=O)[O-])cc2C(=O)/C=C/c2ccc(N(C)C)cc2)OC(CO)C(O)C1O |
| InChI | InChI=1S/C25H29N3O9/c1-14(30)26-22-24(33)23(32)21(13-29)37-25(22)36-20-11-9-17(28(34)35)12-18(20)19(31)10-6-15-4-7-16(8-5-15)27(2)3/h4-12,21-25,29,32-33H,13H2,1-3H3,(H,26,30)/b10-6+ |
| InChIKey | OMUFEMGYFCVHKE-UXBLZVDNSA-N |
| XLogP | 0.88 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|