C18H12ClNO3 — CID 45035488
1-(4-chlorophenyl)-8-methoxy-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium (PubChem CID 45035488) has the molecular formula C18H12ClNO3 and a molecular weight of 325.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-8-methoxy-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium.
| Compound Name | 1-(4-chlorophenyl)-8-methoxy-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium |
|---|---|
| PubChem CID | 45035488 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(4-chlorophenyl)-8-methoxy-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium |
| SMILES | COc1ccc2oc3cc[n+]([O-])c(-c4ccc(Cl)cc4)c3c2c1 |
| InChI | InChI=1S/C18H12ClNO3/c1-22-13-6-7-15-14(10-13)17-16(23-15)8-9-20(21)18(17)11-2-4-12(19)5-3-11/h2-10H,1H3 |
| InChIKey | VHMVCESIQLSKER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|