C23H34O5 — CID 45043600
[(5R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-acetyloxyacetate (PubChem CID 45043600) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(5R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-acetyloxyacetate.
| Compound Name | [(5R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-acetyloxyacetate |
|---|---|
| PubChem CID | 45043600 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(5R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)OC1CC2C3CC[C@H]4CCCCC4(C)C3CCC2(C)C1=O |
| InChI | InChI=1S/C23H34O5/c1-14(24)27-13-20(25)28-19-12-18-16-8-7-15-6-4-5-10-22(15,2)17(16)9-11-23(18,3)21(19)26/h15-19H,4-13H2,1-3H3/t15-,16?,17?,18?,19?,22?,23?/m1/s1 |
| InChIKey | LGXCVDCRXUSHST-VQKZYXLISA-N |
| XLogP | 4.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |