C29H40O2 — CID 45043804
(2Z,5R)-2-[(4-methoxyphenyl)methylidene]-4,4,10,13-tetramethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 45043804) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-4,4,10,13-tetramethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-4,4,10,13-tetramethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 45043804 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-4,4,10,13-tetramethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COc1ccc(/C=C2/CC3(C)C4CCC5(C)CCCC5C4CC[C@H]3C(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C29H40O2/c1-27(2)25-13-12-22-23-7-6-15-28(23,3)16-14-24(22)29(25,4)18-20(26(27)30)17-19-8-10-21(31-5)11-9-19/h8-11,17,22-25H,6-7,12-16,18H2,1-5H3/b20-17-/t22?,23?,24?,25-,28?,29?/m0/s1 |
| InChIKey | WLFXSYTUYMIDAF-LTLXWMJESA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|