C30H48O4 — CID 45044819
[(1S,15R)-5-[(2R,5S)-5,6-dimethylheptan-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-8-en-13-yl] acetate (PubChem CID 45044819) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is [(1S,15R)-5-[(2R,5S)-5,6-dimethylheptan-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-8-en-13-yl] acetate.
| Compound Name | [(1S,15R)-5-[(2R,5S)-5,6-dimethylheptan-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-8-en-13-yl] acetate |
|---|---|
| PubChem CID | 45044819 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [(1S,15R)-5-[(2R,5S)-5,6-dimethylheptan-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-8-en-13-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C3=CCC4(C)C([C@H](C)CC[C@H](C)C(C)C)CCC4[C@@]34CC[C@]2(C1)OO4 |
| InChI | InChI=1S/C30H48O4/c1-19(2)20(3)8-9-21(4)24-10-11-25-27(24,6)14-13-26-28(7)15-12-23(32-22(5)31)18-29(28)16-17-30(25,26)34-33-29/h13,19-21,23-25H,8-12,14-18H2,1-7H3/t20-,21+,23?,24?,25?,27?,28?,29+,30-/m0/s1 |
| InChIKey | VGXFJJGBIOGXFM-YWUGMRBVSA-N |
| XLogP | 7.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|