C17H18N2O7S3 — CID 45047426
acetic acid;2-[(5Z)-5-(1-ethyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid (PubChem CID 45047426) has the molecular formula C17H18N2O7S3 and a molecular weight of 458.54 g/mol. Its IUPAC name is acetic acid;2-[(5Z)-5-(1-ethyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid.
| Compound Name | acetic acid;2-[(5Z)-5-(1-ethyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 45047426 |
| Molecular Formula | C17H18N2O7S3 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | acetic acid;2-[(5Z)-5-(1-ethyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonic acid |
| SMILES | CC(=O)O.CCN1C(=O)/C(=C2\SC(=S)N(CCS(=O)(=O)O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C15H14N2O5S3.C2H4O2/c1-2-16-10-6-4-3-5-9(10)11(13(16)18)12-14(19)17(15(23)24-12)7-8-25(20,21)22;1-2(3)4/h3-6H,2,7-8H2,1H3,(H,20,21,22);1H3,(H,3,4)/b12-11-; |
| InChIKey | CGQOZCMNDVPWSI-AFEZEDKISA-N |
| XLogP | 1.60 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|