C18H20ClN3O2 — CID 45048250
2-(dimethylamino)-N-[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]acetamide;hydrochloride (PubChem CID 45048250) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(dimethylamino)-N-[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45048250 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-(dimethylamino)-N-[4-(3-pyridin-2-ylprop-2-enoyl)phenyl]acetamide;hydrochloride |
| SMILES | CN(C)CC(=O)Nc1ccc(C(=O)C=Cc2ccccn2)cc1.Cl |
| InChI | InChI=1S/C18H19N3O2.ClH/c1-21(2)13-18(23)20-16-8-6-14(7-9-16)17(22)11-10-15-5-3-4-12-19-15;/h3-12H,13H2,1-2H3,(H,20,23);1H |
| InChIKey | HJOSDIYSMPXFIW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|